C23H32O3 — CID 57199170
2-(hydroxymethyl)-4-(8-hydroxy-8-methyl-2-phenylnonan-2-yl)phenol (PubChem CID 57199170) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is 2-(hydroxymethyl)-4-(8-hydroxy-8-methyl-2-phenylnonan-2-yl)phenol.
| Compound Name | 2-(hydroxymethyl)-4-(8-hydroxy-8-methyl-2-phenylnonan-2-yl)phenol |
|---|---|
| PubChem CID | 57199170 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | 2-(hydroxymethyl)-4-(8-hydroxy-8-methyl-2-phenylnonan-2-yl)phenol |
| SMILES | CC(C)(O)CCCCCC(C)(c1ccccc1)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C23H32O3/c1-22(2,26)14-8-5-9-15-23(3,19-10-6-4-7-11-19)20-12-13-21(25)18(16-20)17-24/h4,6-7,10-13,16,24-26H,5,8-9,14-15,17H2,1-3H3 |
| InChIKey | QZTWUWCCMBZDTR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|