C19H24O4 — CID 163710554
4-[2-[4-hydroxy-3-(hydroxymethyl)phenyl]pentan-2-yl]-2-(hydroxymethyl)phenol (PubChem CID 163710554) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-[2-[4-hydroxy-3-(hydroxymethyl)phenyl]pentan-2-yl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[2-[4-hydroxy-3-(hydroxymethyl)phenyl]pentan-2-yl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 163710554 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-[2-[4-hydroxy-3-(hydroxymethyl)phenyl]pentan-2-yl]-2-(hydroxymethyl)phenol |
| SMILES | CCCC(C)(c1ccc(O)c(CO)c1)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C19H24O4/c1-3-8-19(2,15-4-6-17(22)13(9-15)11-20)16-5-7-18(23)14(10-16)12-21/h4-7,9-10,20-23H,3,8,11-12H2,1-2H3 |
| InChIKey | KIVVQGVEMMDYAK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |