C34H40O4 — CID 159320188
4-[2-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenol;4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol (PubChem CID 159320188) has the molecular formula C34H40O4 and a molecular weight of 512.69 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenol;4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol.
| Compound Name | 4-[2-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenol;4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol |
|---|---|
| PubChem CID | 159320188 |
| Molecular Formula | C34H40O4 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.29 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)-3-methylbutan-2-yl]phenol;4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol |
| SMILES | CC(C)C(C)(c1ccc(O)cc1)c1ccc(O)cc1.CCCC(C)(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/2C17H20O2/c1-12(2)17(3,13-4-8-15(18)9-5-13)14-6-10-16(19)11-7-14;1-3-12-17(2,13-4-8-15(18)9-5-13)14-6-10-16(19)11-7-14/h4-12,18-19H,1-3H3;4-11,18-19H,3,12H2,1-2H3 |
| InChIKey | LDQVSJZIYWGFGN-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |