C14H24NO3+ — CID 7815765
butyl-[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]propyl]azanium (PubChem CID 7815765) has the molecular formula C14H24NO3+ and a molecular weight of 254.35 g/mol. Its IUPAC name is butyl-[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]propyl]azanium.
| Compound Name | butyl-[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]propyl]azanium |
|---|---|
| PubChem CID | 7815765 |
| Molecular Formula | C14H24NO3+ |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | butyl-[(2S)-2-hydroxy-2-[4-hydroxy-3-(hydroxymethyl)phenyl]propyl]azanium |
| SMILES | CCCC[NH2+]C[C@@](C)(O)c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C14H23NO3/c1-3-4-7-15-10-14(2,18)12-5-6-13(17)11(8-12)9-16/h5-6,8,15-18H,3-4,7,9-10H2,1-2H3/p+1/t14-/m1/s1 |
| InChIKey | DAGYIROLCLYAJC-CQSZACIVSA-O |
| XLogP | 0.46 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|