C24H32O2 — CID 15322598
4-tert-butyl-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methyl]prop-2-enyl]phenol (PubChem CID 15322598) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 4-tert-butyl-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methyl]prop-2-enyl]phenol.
| Compound Name | 4-tert-butyl-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methyl]prop-2-enyl]phenol |
|---|---|
| PubChem CID | 15322598 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 4-tert-butyl-2-[2-[(5-tert-butyl-2-hydroxyphenyl)methyl]prop-2-enyl]phenol |
| SMILES | C=C(Cc1cc(C(C)(C)C)ccc1O)Cc1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C24H32O2/c1-16(12-17-14-19(23(2,3)4)8-10-21(17)25)13-18-15-20(24(5,6)7)9-11-22(18)26/h8-11,14-15,25-26H,1,12-13H2,2-7H3 |
| InChIKey | PYSLTXUSJKPQQR-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|