C42H52O4 — CID 90829503
4-tert-butyl-2-[1,2,2-tris(5-tert-butyl-2-hydroxyphenyl)ethenyl]phenol (PubChem CID 90829503) has the molecular formula C42H52O4 and a molecular weight of 620.87 g/mol. Its IUPAC name is 4-tert-butyl-2-[1,2,2-tris(5-tert-butyl-2-hydroxyphenyl)ethenyl]phenol.
| Compound Name | 4-tert-butyl-2-[1,2,2-tris(5-tert-butyl-2-hydroxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 90829503 |
| Molecular Formula | C42H52O4 |
| Molecular Weight | 620.87 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | 4-tert-butyl-2-[1,2,2-tris(5-tert-butyl-2-hydroxyphenyl)ethenyl]phenol |
| SMILES | CC(C)(C)c1ccc(O)c(C(=C(c2cc(C(C)(C)C)ccc2O)c2cc(C(C)(C)C)ccc2O)c2cc(C(C)(C)C)ccc2O)c1 |
| InChI | InChI=1S/C42H52O4/c1-39(2,3)25-13-17-33(43)29(21-25)37(30-22-26(40(4,5)6)14-18-34(30)44)38(31-23-27(41(7,8)9)15-19-35(31)45)32-24-28(42(10,11)12)16-20-36(32)46/h13-24,43-46H,1-12H3 |
| InChIKey | OLVYEAFUPFDGCV-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.87 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|