C44H56O4 — CID 12990064
4-tert-butyl-2-[(Z)-2-(5-tert-butyl-2-hydroxyphenyl)-1,2-bis(5-tert-butyl-2-methoxyphenyl)ethenyl]phenol (PubChem CID 12990064) has the molecular formula C44H56O4 and a molecular weight of 648.93 g/mol. Its IUPAC name is 4-tert-butyl-2-[(Z)-2-(5-tert-butyl-2-hydroxyphenyl)-1,2-bis(5-tert-butyl-2-methoxyphenyl)ethenyl]phenol.
| Compound Name | 4-tert-butyl-2-[(Z)-2-(5-tert-butyl-2-hydroxyphenyl)-1,2-bis(5-tert-butyl-2-methoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 12990064 |
| Molecular Formula | C44H56O4 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.42 |
| IUPAC Name | 4-tert-butyl-2-[(Z)-2-(5-tert-butyl-2-hydroxyphenyl)-1,2-bis(5-tert-butyl-2-methoxyphenyl)ethenyl]phenol |
| SMILES | COc1ccc(C(C)(C)C)cc1/C(=C(/c1cc(C(C)(C)C)ccc1O)c1cc(C(C)(C)C)ccc1OC)c1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C44H56O4/c1-41(2,3)27-15-19-35(45)31(23-27)39(33-25-29(43(7,8)9)17-21-37(33)47-13)40(32-24-28(42(4,5)6)16-20-36(32)46)34-26-30(44(10,11)12)18-22-38(34)48-14/h15-26,45-46H,1-14H3/b40-39- |
| InChIKey | YPSBSLRHNYGCLD-MRNGAQBPSA-N |
| XLogP | 11.31 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|