About 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide
5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide (PubChem CID 116827761) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide |
| PubChem CID | 116827761 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1cc(C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C13H20N2O/c1-13(2,3)9-6-7-11(16-5)10(8-9)12(14)15-4/h6-8H,1-5H3,(H2,14,15) |
| InChIKey | SLPWRCNROVGLSD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide?
The IUPAC name of 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide (CID 116827761) is 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide.
What is the SMILES notation for 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide?
The canonical SMILES for 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide is C/N=C(\N)c1cc(C(C)(C)C)ccc1OC.
What is the InChIKey of 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide?
The InChIKey is SLPWRCNROVGLSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-13(2,3)9-6-7-11(16-5)10(8-9)12(14)15-4/h6-8H,1-5H3,(H2,14,15).
What are the key properties of 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide?
5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide has a molecular weight of 220.32 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-methoxy-N'-methylbenzenecarboximidamide is sourced from PubChem (CID 116827761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).