C20H26O4 — CID 139838646
4-[2-(4-hydroxyphenyl)octan-2-yl]benzene-1,2,3-triol (PubChem CID 139838646) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is 4-[2-(4-hydroxyphenyl)octan-2-yl]benzene-1,2,3-triol.
| Compound Name | 4-[2-(4-hydroxyphenyl)octan-2-yl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 139838646 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 4-[2-(4-hydroxyphenyl)octan-2-yl]benzene-1,2,3-triol |
| SMILES | CCCCCCC(C)(c1ccc(O)cc1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C20H26O4/c1-3-4-5-6-13-20(2,14-7-9-15(21)10-8-14)16-11-12-17(22)19(24)18(16)23/h7-12,21-24H,3-6,13H2,1-2H3 |
| InChIKey | KZXFCXDEYZXKQN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|