C24H32O3 — CID 139676721
2-hydroxy-6-methyl-3-(2-phenyldecan-2-yl)benzoic acid (PubChem CID 139676721) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-hydroxy-6-methyl-3-(2-phenyldecan-2-yl)benzoic acid.
| Compound Name | 2-hydroxy-6-methyl-3-(2-phenyldecan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 139676721 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 2-hydroxy-6-methyl-3-(2-phenyldecan-2-yl)benzoic acid |
| SMILES | CCCCCCCCC(C)(c1ccccc1)c1ccc(C)c(C(=O)O)c1O |
| InChI | InChI=1S/C24H32O3/c1-4-5-6-7-8-12-17-24(3,19-13-10-9-11-14-19)20-16-15-18(2)21(22(20)25)23(26)27/h9-11,13-16,25H,4-8,12,17H2,1-3H3,(H,26,27) |
| InChIKey | GFUOZSYNJSNAQR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|