C9H19IO2 — CID 134992570
(3R,4R)-4-iodononane-1,3-diol (PubChem CID 134992570) has the molecular formula C9H19IO2 and a molecular weight of 286.15 g/mol. Its IUPAC name is (3R,4R)-4-iodononane-1,3-diol.
| Compound Name | (3R,4R)-4-iodononane-1,3-diol |
|---|---|
| PubChem CID | 134992570 |
| Molecular Formula | C9H19IO2 |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | (3R,4R)-4-iodononane-1,3-diol |
| SMILES | CCCCC[C@@H](I)[C@H](O)CCO |
| InChI | InChI=1S/C9H19IO2/c1-2-3-4-5-8(10)9(12)6-7-11/h8-9,11-12H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | ZAKURNXQLDCBBN-RKDXNWHRSA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|