C19H40O3 — CID 154366678
7-methyloctadecane-1,3,4-triol (PubChem CID 154366678) has the molecular formula C19H40O3 and a molecular weight of 316.53 g/mol. Its IUPAC name is 7-methyloctadecane-1,3,4-triol.
| Compound Name | 7-methyloctadecane-1,3,4-triol |
|---|---|
| PubChem CID | 154366678 |
| Molecular Formula | C19H40O3 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.30 |
| IUPAC Name | 7-methyloctadecane-1,3,4-triol |
| SMILES | CCCCCCCCCCCC(C)CCC(O)C(O)CCO |
| InChI | InChI=1S/C19H40O3/c1-3-4-5-6-7-8-9-10-11-12-17(2)13-14-18(21)19(22)15-16-20/h17-22H,3-16H2,1-2H3 |
| InChIKey | FHDHPKZIHSRQOX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|