C35H56O2 — CID 139825092
2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)heptan-3-yl]phenol (PubChem CID 139825092) has the molecular formula C35H56O2 and a molecular weight of 508.83 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)heptan-3-yl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)heptan-3-yl]phenol |
|---|---|
| PubChem CID | 139825092 |
| Molecular Formula | C35H56O2 |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 508.43 |
| IUPAC Name | 2,6-ditert-butyl-4-[3-(3,5-ditert-butyl-4-hydroxyphenyl)heptan-3-yl]phenol |
| SMILES | CCCCC(CC)(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H56O2/c1-15-17-18-35(16-2,23-19-25(31(3,4)5)29(36)26(20-23)32(6,7)8)24-21-27(33(9,10)11)30(37)28(22-24)34(12,13)14/h19-22,36-37H,15-18H2,1-14H3 |
| InChIKey | VDJXMVKFQAZWSZ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |