C39H72OS3 — CID 10941338
2,6-ditert-butyl-4-[tris(octylsulfanyl)methyl]phenol (PubChem CID 10941338) has the molecular formula C39H72OS3 and a molecular weight of 653.21 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[tris(octylsulfanyl)methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[tris(octylsulfanyl)methyl]phenol |
|---|---|
| PubChem CID | 10941338 |
| Molecular Formula | C39H72OS3 |
| Molecular Weight | 653.21 g/mol |
| Exact Mass | 652.47 |
| IUPAC Name | 2,6-ditert-butyl-4-[tris(octylsulfanyl)methyl]phenol |
| SMILES | CCCCCCCCSC(SCCCCCCCC)(SCCCCCCCC)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C39H72OS3/c1-10-13-16-19-22-25-28-41-39(42-29-26-23-20-17-14-11-2,43-30-27-24-21-18-15-12-3)33-31-34(37(4,5)6)36(40)35(32-33)38(7,8)9/h31-32,40H,10-30H2,1-9H3 |
| InChIKey | CZZUFPSNALIFRU-UHFFFAOYSA-N |
| XLogP | 14.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.21 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|