C25H42O3S — CID 54464585
2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate (PubChem CID 54464585) has the molecular formula C25H42O3S and a molecular weight of 422.68 g/mol. Its IUPAC name is 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate.
| Compound Name | 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate |
|---|---|
| PubChem CID | 54464585 |
| Molecular Formula | C25H42O3S |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate |
| SMILES | CCCCCCCCSCCOC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H42O3S/c1-8-9-10-11-12-13-15-29-16-14-28-23(27)20-17-19(24(2,3)4)18-21(22(20)26)25(5,6)7/h17-18,26H,8-16H2,1-7H3 |
| InChIKey | XDYPNCQRMPCKRI-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|