2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate

C25H42O3S — CID 54464585

IUPAC2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate
SMILESCCCCCCCCSCCOC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O
InChIInChI=1S/C25H42O3S/c1-8-9-10-11-12-13-15-29-16-14-28-23(27)20-17-19(24(2,3)4)18-21(22(20)26)25(5,6)7/h17-18,26H,8-16H2,1-7H3
InChIKeyXDYPNCQRMPCKRI-UHFFFAOYSA-N
MW422.68 g/mol
LogP7.24
Rot. Bonds11

About 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate

2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate (PubChem CID 54464585) has the molecular formula C25H42O3S and a molecular weight of 422.68 g/mol. Its IUPAC name is 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate.

Molecular Properties

Compound Name2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate
PubChem CID54464585
Molecular FormulaC25H42O3S
Molecular Weight422.68 g/mol
Exact Mass422.29
IUPAC Name2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate
SMILESCCCCCCCCSCCOC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O
InChIInChI=1S/C25H42O3S/c1-8-9-10-11-12-13-15-29-16-14-28-23(27)20-17-19(24(2,3)4)18-21(22(20)26)25(5,6)7/h17-18,26H,8-16H2,1-7H3
InChIKeyXDYPNCQRMPCKRI-UHFFFAOYSA-N
XLogP7.24
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds11
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500422.68
LogP ≤ 57.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate?
The IUPAC name of 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate (CID 54464585) is 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate.
What is the SMILES notation for 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate?
The canonical SMILES for 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate is CCCCCCCCSCCOC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O.
What is the InChIKey of 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate?
The InChIKey is XDYPNCQRMPCKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H42O3S/c1-8-9-10-11-12-13-15-29-16-14-28-23(27)20-17-19(24(2,3)4)18-21(22(20)26)25(5,6)7/h17-18,26H,8-16H2,1-7H3.
What are the key properties of 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate?
2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate has a molecular weight of 422.68 g/mol, XLogP of 7.24, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylsulfanylethyl 3,5-ditert-butyl-2-hydroxybenzoate is sourced from PubChem (CID 54464585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).