C23H38O4 — CID 175327364
octyl 3,5-ditert-butyl-2,4-dihydroxybenzoate (PubChem CID 175327364) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is octyl 3,5-ditert-butyl-2,4-dihydroxybenzoate.
| Compound Name | octyl 3,5-ditert-butyl-2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 175327364 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | octyl 3,5-ditert-butyl-2,4-dihydroxybenzoate |
| SMILES | CCCCCCCCOC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H38O4/c1-8-9-10-11-12-13-14-27-21(26)16-15-17(22(2,3)4)20(25)18(19(16)24)23(5,6)7/h15,24-25H,8-14H2,1-7H3 |
| InChIKey | WKJPJACVOJHCMZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|