C31H46O4 — CID 69306762
2,2-bis(3,5-dibutyl-4-hydroxyphenyl)propanoic acid (PubChem CID 69306762) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is 2,2-bis(3,5-dibutyl-4-hydroxyphenyl)propanoic acid.
| Compound Name | 2,2-bis(3,5-dibutyl-4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 69306762 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 2,2-bis(3,5-dibutyl-4-hydroxyphenyl)propanoic acid |
| SMILES | CCCCc1cc(C(C)(C(=O)O)c2cc(CCCC)c(O)c(CCCC)c2)cc(CCCC)c1O |
| InChI | InChI=1S/C31H46O4/c1-6-10-14-22-18-26(19-23(28(22)32)15-11-7-2)31(5,30(34)35)27-20-24(16-12-8-3)29(33)25(21-27)17-13-9-4/h18-21,32-33H,6-17H2,1-5H3,(H,34,35) |
| InChIKey | KFXCIVWTMVZYPM-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |