C14H21NO3 — CID 54366619
2,6-dibutyl-4-nitrophenol (PubChem CID 54366619) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,6-dibutyl-4-nitrophenol.
| Compound Name | 2,6-dibutyl-4-nitrophenol |
|---|---|
| PubChem CID | 54366619 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2,6-dibutyl-4-nitrophenol |
| SMILES | CCCCc1cc([N+](=O)[O-])cc(CCCC)c1O |
| InChI | InChI=1S/C14H21NO3/c1-3-5-7-11-9-13(15(17)18)10-12(14(11)16)8-6-4-2/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | UQFRPVXWZVWGFY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|