C16H27N3O3 — CID 14293691
2,6-bis(diethylaminomethyl)-4-nitrophenol (PubChem CID 14293691) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2,6-bis(diethylaminomethyl)-4-nitrophenol.
| Compound Name | 2,6-bis(diethylaminomethyl)-4-nitrophenol |
|---|---|
| PubChem CID | 14293691 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2,6-bis(diethylaminomethyl)-4-nitrophenol |
| SMILES | CCN(CC)Cc1cc([N+](=O)[O-])cc(CN(CC)CC)c1O |
| InChI | InChI=1S/C16H27N3O3/c1-5-17(6-2)11-13-9-15(19(21)22)10-14(16(13)20)12-18(7-3)8-4/h9-10,20H,5-8,11-12H2,1-4H3 |
| InChIKey | MAEZIIUSIKSULB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|