C21H39N3O — CID 18544187
2,4,6-tris(diethylaminomethyl)phenol (PubChem CID 18544187) has the molecular formula C21H39N3O and a molecular weight of 349.56 g/mol. Its IUPAC name is 2,4,6-tris(diethylaminomethyl)phenol.
| Compound Name | 2,4,6-tris(diethylaminomethyl)phenol |
|---|---|
| PubChem CID | 18544187 |
| Molecular Formula | C21H39N3O |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | 2,4,6-tris(diethylaminomethyl)phenol |
| SMILES | CCN(CC)Cc1cc(CN(CC)CC)c(O)c(CN(CC)CC)c1 |
| InChI | InChI=1S/C21H39N3O/c1-7-22(8-2)15-18-13-19(16-23(9-3)10-4)21(25)20(14-18)17-24(11-5)12-6/h13-14,25H,7-12,15-17H2,1-6H3 |
| InChIKey | WIIVKNLYINAMDA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|