C15H23ClN2O2 — CID 63479699
N-[(2-chloro-5-nitrophenyl)methyl]-N,2-diethylbutan-1-amine (PubChem CID 63479699) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-N,2-diethylbutan-1-amine.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-N,2-diethylbutan-1-amine |
|---|---|
| PubChem CID | 63479699 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-N,2-diethylbutan-1-amine |
| SMILES | CCC(CC)CN(CC)Cc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C15H23ClN2O2/c1-4-12(5-2)10-17(6-3)11-13-9-14(18(19)20)7-8-15(13)16/h7-9,12H,4-6,10-11H2,1-3H3 |
| InChIKey | GPKIEROWSIYYPX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|