C10H11ClF2N2O2 — CID 115624782
N-[(2-chloro-5-nitrophenyl)methyl]-2,2-difluoro-N-methylethanamine (PubChem CID 115624782) has the molecular formula C10H11ClF2N2O2 and a molecular weight of 264.66 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-2,2-difluoro-N-methylethanamine.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-2,2-difluoro-N-methylethanamine |
|---|---|
| PubChem CID | 115624782 |
| Molecular Formula | C10H11ClF2N2O2 |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-2,2-difluoro-N-methylethanamine |
| SMILES | CN(Cc1cc([N+](=O)[O-])ccc1Cl)CC(F)F |
| InChI | InChI=1S/C10H11ClF2N2O2/c1-14(6-10(12)13)5-7-4-8(15(16)17)2-3-9(7)11/h2-4,10H,5-6H2,1H3 |
| InChIKey | WYUMNXJIUMGYPX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|