C20H33N3O3 — CID 130249224
2-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]-4-nitrophenol (PubChem CID 130249224) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]-4-nitrophenol.
| Compound Name | 2-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 130249224 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 2-butyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]-4-nitrophenol |
| SMILES | CCCCc1cc([N+](=O)[O-])cc(CN(C)[C@@H]2CCCC[C@H]2N(C)C)c1O |
| InChI | InChI=1S/C20H33N3O3/c1-5-6-9-15-12-17(23(25)26)13-16(20(15)24)14-22(4)19-11-8-7-10-18(19)21(2)3/h12-13,18-19,24H,5-11,14H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | AACKPALUHZXKTL-RTBURBONSA-N |
| XLogP | 3.95 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|