C15H21FN2O4S — CID 124840904
cis-(1S,2R)-N-[(2-fluoro-4-nitrophenyl)methyl]-N-methyl-2-methylsulfonylcyclohexan-1-amine (PubChem CID 124840904) has the molecular formula C15H21FN2O4S and a molecular weight of 344.41 g/mol. Its IUPAC name is cis-(1S,2R)-N-[(2-fluoro-4-nitrophenyl)methyl]-N-methyl-2-methylsulfonylcyclohexan-1-amine.
| Compound Name | cis-(1S,2R)-N-[(2-fluoro-4-nitrophenyl)methyl]-N-methyl-2-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 124840904 |
| Molecular Formula | C15H21FN2O4S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | cis-(1S,2R)-N-[(2-fluoro-4-nitrophenyl)methyl]-N-methyl-2-methylsulfonylcyclohexan-1-amine |
| SMILES | CN(Cc1ccc([N+](=O)[O-])cc1F)[C@H]1CCCC[C@H]1S(C)(=O)=O |
| InChI | InChI=1S/C15H21FN2O4S/c1-17(14-5-3-4-6-15(14)23(2,21)22)10-11-7-8-12(18(19)20)9-13(11)16/h7-9,14-15H,3-6,10H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | QRYLBLWWMJQUPP-LSDHHAIUSA-N |
| XLogP | 2.52 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|