C14H12F2N2O4S — CID 31818110
N-[(2,4-difluorophenyl)methyl]-N-methyl-4-nitrobenzenesulfonamide (PubChem CID 31818110) has the molecular formula C14H12F2N2O4S and a molecular weight of 342.32 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-N-methyl-4-nitrobenzenesulfonamide.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-N-methyl-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 31818110 |
| Molecular Formula | C14H12F2N2O4S |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-N-methyl-4-nitrobenzenesulfonamide |
| SMILES | CN(Cc1ccc(F)cc1F)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H12F2N2O4S/c1-17(9-10-2-3-11(15)8-14(10)16)23(21,22)13-6-4-12(5-7-13)18(19)20/h2-8H,9H2,1H3 |
| InChIKey | HDUVUUIRAAWXBZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|