C18H24FNO2 — CID 142228274
2-fluoro-1-[[1-(4-methylcyclohexyl)cyclobutyl]methyl]-4-nitrobenzene (PubChem CID 142228274) has the molecular formula C18H24FNO2 and a molecular weight of 305.39 g/mol. Its IUPAC name is 2-fluoro-1-[[1-(4-methylcyclohexyl)cyclobutyl]methyl]-4-nitrobenzene.
| Compound Name | 2-fluoro-1-[[1-(4-methylcyclohexyl)cyclobutyl]methyl]-4-nitrobenzene |
|---|---|
| PubChem CID | 142228274 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 2-fluoro-1-[[1-(4-methylcyclohexyl)cyclobutyl]methyl]-4-nitrobenzene |
| SMILES | CC1CCC(C2(Cc3ccc([N+](=O)[O-])cc3F)CCC2)CC1 |
| InChI | InChI=1S/C18H24FNO2/c1-13-3-6-15(7-4-13)18(9-2-10-18)12-14-5-8-16(20(21)22)11-17(14)19/h5,8,11,13,15H,2-4,6-7,9-10,12H2,1H3 |
| InChIKey | YEDODOCKLHFXCQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|