C24H42N2O — CID 130247611
2,4-dibutyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]phenol (PubChem CID 130247611) has the molecular formula C24H42N2O and a molecular weight of 374.61 g/mol. Its IUPAC name is 2,4-dibutyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]phenol.
| Compound Name | 2,4-dibutyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]phenol |
|---|---|
| PubChem CID | 130247611 |
| Molecular Formula | C24H42N2O |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | 2,4-dibutyl-6-[[[(1R,2R)-2-(dimethylamino)cyclohexyl]-methylamino]methyl]phenol |
| SMILES | CCCCc1cc(CCCC)c(O)c(CN(C)[C@@H]2CCCC[C@H]2N(C)C)c1 |
| InChI | InChI=1S/C24H42N2O/c1-6-8-12-19-16-20(13-9-7-2)24(27)21(17-19)18-26(5)23-15-11-10-14-22(23)25(3)4/h16-17,22-23,27H,6-15,18H2,1-5H3/t22-,23-/m1/s1 |
| InChIKey | PZYGYFNAXMCNPM-DHIUTWEWSA-N |
| XLogP | 5.38 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|