C14H22N2O2 — CID 67257238
2,3-dibutyl-5-nitroaniline (PubChem CID 67257238) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,3-dibutyl-5-nitroaniline.
| Compound Name | 2,3-dibutyl-5-nitroaniline |
|---|---|
| PubChem CID | 67257238 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2,3-dibutyl-5-nitroaniline |
| SMILES | CCCCc1cc([N+](=O)[O-])cc(N)c1CCCC |
| InChI | InChI=1S/C14H22N2O2/c1-3-5-7-11-9-12(16(17)18)10-14(15)13(11)8-6-4-2/h9-10H,3-8,15H2,1-2H3 |
| InChIKey | NWFJEXWAVXWNIK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|