C33H56N4O4 — CID 161462362
5-decylbenzene-1,3-diamine;1-decyl-3,5-dinitrobenzene;methane (PubChem CID 161462362) has the molecular formula C33H56N4O4 and a molecular weight of 572.84 g/mol. Its IUPAC name is 5-decylbenzene-1,3-diamine;1-decyl-3,5-dinitrobenzene;methane.
| Compound Name | 5-decylbenzene-1,3-diamine;1-decyl-3,5-dinitrobenzene;methane |
|---|---|
| PubChem CID | 161462362 |
| Molecular Formula | C33H56N4O4 |
| Molecular Weight | 572.84 g/mol |
| Exact Mass | 572.43 |
| IUPAC Name | 5-decylbenzene-1,3-diamine;1-decyl-3,5-dinitrobenzene;methane |
| SMILES | C.CCCCCCCCCCc1cc(N)cc(N)c1.CCCCCCCCCCc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24N2O4.C16H28N2.CH4/c1-2-3-4-5-6-7-8-9-10-14-11-15(17(19)20)13-16(12-14)18(21)22;1-2-3-4-5-6-7-8-9-10-14-11-15(17)13-16(18)12-14;/h11-13H,2-10H2,1H3;11-13H,2-10,17-18H2,1H3;1H4 |
| InChIKey | WBZFKMRWKJTSMX-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.84 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|