C30H39O3P — CID 153324599
tris(2,3,4,5-tetramethylphenyl) phosphite (PubChem CID 153324599) has the molecular formula C30H39O3P and a molecular weight of 478.61 g/mol. Its IUPAC name is tris(2,3,4,5-tetramethylphenyl) phosphite.
| Compound Name | tris(2,3,4,5-tetramethylphenyl) phosphite |
|---|---|
| PubChem CID | 153324599 |
| Molecular Formula | C30H39O3P |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | tris(2,3,4,5-tetramethylphenyl) phosphite |
| SMILES | Cc1cc(OP(Oc2cc(C)c(C)c(C)c2C)Oc2cc(C)c(C)c(C)c2C)c(C)c(C)c1C |
| InChI | InChI=1S/C30H39O3P/c1-16-13-28(25(10)22(7)19(16)4)31-34(32-29-14-17(2)20(5)23(8)26(29)11)33-30-15-18(3)21(6)24(9)27(30)12/h13-15H,1-12H3 |
| InChIKey | GVFVJOBRYWRPNU-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|