C27H33O3P — CID 627271
tris(2,3,5-trimethylphenyl) phosphite (PubChem CID 627271) has the molecular formula C27H33O3P and a molecular weight of 436.53 g/mol. Its IUPAC name is tris(2,3,5-trimethylphenyl) phosphite.
| Compound Name | tris(2,3,5-trimethylphenyl) phosphite |
|---|---|
| PubChem CID | 627271 |
| Molecular Formula | C27H33O3P |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | tris(2,3,5-trimethylphenyl) phosphite |
| SMILES | Cc1cc(C)c(C)c(OP(Oc2cc(C)cc(C)c2C)Oc2cc(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C27H33O3P/c1-16-10-19(4)22(7)25(13-16)28-31(29-26-14-17(2)11-20(5)23(26)8)30-27-15-18(3)12-21(6)24(27)9/h10-15H,1-9H3 |
| InChIKey | QDJQZQUFHPYVJH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|