C18H22O — CID 71382789
1-(2,5-dimethylphenoxy)-2,3,4,5-tetramethylbenzene (PubChem CID 71382789) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-(2,5-dimethylphenoxy)-2,3,4,5-tetramethylbenzene.
| Compound Name | 1-(2,5-dimethylphenoxy)-2,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 71382789 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 1-(2,5-dimethylphenoxy)-2,3,4,5-tetramethylbenzene |
| SMILES | Cc1ccc(C)c(Oc2cc(C)c(C)c(C)c2C)c1 |
| InChI | InChI=1S/C18H22O/c1-11-7-8-12(2)17(9-11)19-18-10-13(3)14(4)15(5)16(18)6/h7-10H,1-6H3 |
| InChIKey | IUTLVLWDQWITAE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |