C16H18O2PS2- — CID 101310913
bis(2,5-dimethylphenoxy)-disulfidophosphanium (PubChem CID 101310913) has the molecular formula C16H18O2PS2- and a molecular weight of 337.43 g/mol. Its IUPAC name is bis(2,5-dimethylphenoxy)-disulfidophosphanium.
| Compound Name | bis(2,5-dimethylphenoxy)-disulfidophosphanium |
|---|---|
| PubChem CID | 101310913 |
| Molecular Formula | C16H18O2PS2- |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | bis(2,5-dimethylphenoxy)-disulfidophosphanium |
| SMILES | Cc1ccc(C)c(O[P+]([S-])([S-])Oc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C16H19O2PS2/c1-11-5-7-13(3)15(9-11)17-19(20,21)18-16-10-12(2)6-8-14(16)4/h5-10H,1-4H3,(H,20,21)/p-1 |
| InChIKey | DSVPXACLWJECFL-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|