C18H22O2 — CID 69386639
2-[1-(4-ethylphenoxy)ethoxy]-1,4-dimethylbenzene (PubChem CID 69386639) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[1-(4-ethylphenoxy)ethoxy]-1,4-dimethylbenzene.
| Compound Name | 2-[1-(4-ethylphenoxy)ethoxy]-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 69386639 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-[1-(4-ethylphenoxy)ethoxy]-1,4-dimethylbenzene |
| SMILES | CCc1ccc(OC(C)Oc2cc(C)ccc2C)cc1 |
| InChI | InChI=1S/C18H22O2/c1-5-16-8-10-17(11-9-16)19-15(4)20-18-12-13(2)6-7-14(18)3/h6-12,15H,5H2,1-4H3 |
| InChIKey | ULEKUSAGZPDPMQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|