C11H17NO — CID 70392108
1-(2,5-dimethylphenoxy)propan-1-amine (PubChem CID 70392108) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1-(2,5-dimethylphenoxy)propan-1-amine.
| Compound Name | 1-(2,5-dimethylphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 70392108 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1-(2,5-dimethylphenoxy)propan-1-amine |
| SMILES | CCC(N)Oc1cc(C)ccc1C |
| InChI | InChI=1S/C11H17NO/c1-4-11(12)13-10-7-8(2)5-6-9(10)3/h5-7,11H,4,12H2,1-3H3 |
| InChIKey | YUMCOJGBYLFXGF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|