C19H25NO — CID 63802262
1-[4-(2,5-dimethylphenoxy)-2-methylphenyl]butan-2-amine (PubChem CID 63802262) has the molecular formula C19H25NO and a molecular weight of 283.42 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylphenoxy)-2-methylphenyl]butan-2-amine.
| Compound Name | 1-[4-(2,5-dimethylphenoxy)-2-methylphenyl]butan-2-amine |
|---|---|
| PubChem CID | 63802262 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-[4-(2,5-dimethylphenoxy)-2-methylphenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Oc2cc(C)ccc2C)cc1C |
| InChI | InChI=1S/C19H25NO/c1-5-17(20)12-16-8-9-18(11-15(16)4)21-19-10-13(2)6-7-14(19)3/h6-11,17H,5,12,20H2,1-4H3 |
| InChIKey | VNJLWFJHWZZRHV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |