C12H18O — CID 20737129
2-butan-2-yloxy-1,4-dimethylbenzene (PubChem CID 20737129) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is 2-butan-2-yloxy-1,4-dimethylbenzene.
| Compound Name | 2-butan-2-yloxy-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 20737129 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-butan-2-yloxy-1,4-dimethylbenzene |
| SMILES | CCC(C)Oc1cc(C)ccc1C |
| InChI | InChI=1S/C12H18O/c1-5-11(4)13-12-8-9(2)6-7-10(12)3/h6-8,11H,5H2,1-4H3 |
| InChIKey | JSIXGVOUNLDXPG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |