C14H24O — CID 142890016
1-butan-2-yloxy-2,4-dimethylbenzene;ethane (PubChem CID 142890016) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1-butan-2-yloxy-2,4-dimethylbenzene;ethane.
| Compound Name | 1-butan-2-yloxy-2,4-dimethylbenzene;ethane |
|---|---|
| PubChem CID | 142890016 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1-butan-2-yloxy-2,4-dimethylbenzene;ethane |
| SMILES | CC.CCC(C)Oc1ccc(C)cc1C |
| InChI | InChI=1S/C12H18O.C2H6/c1-5-11(4)13-12-7-6-9(2)8-10(12)3;1-2/h6-8,11H,5H2,1-4H3;1-2H3 |
| InChIKey | BOQWLXVWVCETFM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |