C12H18O2 — CID 70331927
1-[(2R)-1-methoxypropan-2-yl]oxy-2,4-dimethylbenzene (PubChem CID 70331927) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 1-[(2R)-1-methoxypropan-2-yl]oxy-2,4-dimethylbenzene.
| Compound Name | 1-[(2R)-1-methoxypropan-2-yl]oxy-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 70331927 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 1-[(2R)-1-methoxypropan-2-yl]oxy-2,4-dimethylbenzene |
| SMILES | COC[C@@H](C)Oc1ccc(C)cc1C |
| InChI | InChI=1S/C12H18O2/c1-9-5-6-12(10(2)7-9)14-11(3)8-13-4/h5-7,11H,8H2,1-4H3/t11-/m1/s1 |
| InChIKey | ZFIAEVXNZWYYTA-LLVKDONJSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |