C14H24O4 — CID 90686409
1,2-dimethoxy-4-methylbenzene;1,2-dimethoxypropane (PubChem CID 90686409) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 1,2-dimethoxy-4-methylbenzene;1,2-dimethoxypropane.
| Compound Name | 1,2-dimethoxy-4-methylbenzene;1,2-dimethoxypropane |
|---|---|
| PubChem CID | 90686409 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1,2-dimethoxy-4-methylbenzene;1,2-dimethoxypropane |
| SMILES | COCC(C)OC.COc1ccc(C)cc1OC |
| InChI | InChI=1S/C9H12O2.C5H12O2/c1-7-4-5-8(10-2)9(6-7)11-3;1-5(7-3)4-6-2/h4-6H,1-3H3;5H,4H2,1-3H3 |
| InChIKey | LZVYZRKMAPCDTK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |