C20H27NO2 — CID 54802671
3-butan-2-yloxy-N-[2-(2,5-dimethylphenoxy)ethyl]aniline (PubChem CID 54802671) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[2-(2,5-dimethylphenoxy)ethyl]aniline.
| Compound Name | 3-butan-2-yloxy-N-[2-(2,5-dimethylphenoxy)ethyl]aniline |
|---|---|
| PubChem CID | 54802671 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 3-butan-2-yloxy-N-[2-(2,5-dimethylphenoxy)ethyl]aniline |
| SMILES | CCC(C)Oc1cccc(NCCOc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C20H27NO2/c1-5-17(4)23-19-8-6-7-18(14-19)21-11-12-22-20-13-15(2)9-10-16(20)3/h6-10,13-14,17,21H,5,11-12H2,1-4H3 |
| InChIKey | CXTTUSOIKCGIFF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|