C16H18O3 — CID 22041993
4-(4-hydroxy-2,5-dimethylphenoxy)-2,5-dimethylphenol (PubChem CID 22041993) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(4-hydroxy-2,5-dimethylphenoxy)-2,5-dimethylphenol.
| Compound Name | 4-(4-hydroxy-2,5-dimethylphenoxy)-2,5-dimethylphenol |
|---|---|
| PubChem CID | 22041993 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 4-(4-hydroxy-2,5-dimethylphenoxy)-2,5-dimethylphenol |
| SMILES | Cc1cc(Oc2cc(C)c(O)cc2C)c(C)cc1O |
| InChI | InChI=1S/C16H18O3/c1-9-7-15(11(3)5-13(9)17)19-16-8-10(2)14(18)6-12(16)4/h5-8,17-18H,1-4H3 |
| InChIKey | IDBXWBTZOWNCAX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |