C7H9NO2 — CID 14549398
2-amino-5-methylbenzene-1,4-diol (PubChem CID 14549398) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 2-amino-5-methylbenzene-1,4-diol.
| Compound Name | 2-amino-5-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 14549398 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 2-amino-5-methylbenzene-1,4-diol |
| SMILES | Cc1cc(O)c(N)cc1O |
| InChI | InChI=1S/C7H9NO2/c1-4-2-7(10)5(8)3-6(4)9/h2-3,9-10H,8H2,1H3 |
| InChIKey | UWVORFGFONZFRB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|