About 2-amino-5-hydroxy-4-methylbenzonitrile;ethane
2-amino-5-hydroxy-4-methylbenzonitrile;ethane (PubChem CID 143940980) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 2-amino-5-hydroxy-4-methylbenzonitrile;ethane.
Molecular Properties
| Compound Name | 2-amino-5-hydroxy-4-methylbenzonitrile;ethane |
| PubChem CID | 143940980 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 2-amino-5-hydroxy-4-methylbenzonitrile;ethane |
| SMILES | CC.CC.CC.Cc1cc(N)c(C#N)cc1O |
| InChI | InChI=1S/C8H8N2O.3C2H6/c1-5-2-7(10)6(4-9)3-8(5)11;3*1-2/h2-3,11H,10H2,1H3;3*1-2H3 |
| InChIKey | AOTIZQWTJXJDTN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-hydroxy-4-methylbenzonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-hydroxy-4-methylbenzonitrile;ethane?
The IUPAC name of 2-amino-5-hydroxy-4-methylbenzonitrile;ethane (CID 143940980) is 2-amino-5-hydroxy-4-methylbenzonitrile;ethane.
What is the SMILES notation for 2-amino-5-hydroxy-4-methylbenzonitrile;ethane?
The canonical SMILES for 2-amino-5-hydroxy-4-methylbenzonitrile;ethane is CC.CC.CC.Cc1cc(N)c(C#N)cc1O.
What is the InChIKey of 2-amino-5-hydroxy-4-methylbenzonitrile;ethane?
The InChIKey is AOTIZQWTJXJDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O.3C2H6/c1-5-2-7(10)6(4-9)3-8(5)11;3*1-2/h2-3,11H,10H2,1H3;3*1-2H3.
What are the key properties of 2-amino-5-hydroxy-4-methylbenzonitrile;ethane?
2-amino-5-hydroxy-4-methylbenzonitrile;ethane has a molecular weight of 238.37 g/mol, XLogP of 4.23, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-hydroxy-4-methylbenzonitrile;ethane is sourced from PubChem (CID 143940980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).