C33H54O2 — CID 142616771
(3Z)-5,6-dimethylhepta-3,5-dien-1-yne;4-(3,4-dimethylphenoxy)-2,5-dimethylphenol;ethane (PubChem CID 142616771) has the molecular formula C33H54O2 and a molecular weight of 482.79 g/mol. Its IUPAC name is (3Z)-5,6-dimethylhepta-3,5-dien-1-yne;4-(3,4-dimethylphenoxy)-2,5-dimethylphenol;ethane.
| Compound Name | (3Z)-5,6-dimethylhepta-3,5-dien-1-yne;4-(3,4-dimethylphenoxy)-2,5-dimethylphenol;ethane |
|---|---|
| PubChem CID | 142616771 |
| Molecular Formula | C33H54O2 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 482.41 |
| IUPAC Name | (3Z)-5,6-dimethylhepta-3,5-dien-1-yne;4-(3,4-dimethylphenoxy)-2,5-dimethylphenol;ethane |
| SMILES | C#C/C=C\C(C)=C(C)C.CC.CC.CC.CC.Cc1ccc(Oc2cc(C)c(O)cc2C)cc1C |
| InChI | InChI=1S/C16H18O2.C9H12.4C2H6/c1-10-5-6-14(7-11(10)2)18-16-9-12(3)15(17)8-13(16)4;1-5-6-7-9(4)8(2)3;4*1-2/h5-9,17H,1-4H3;1,6-7H,2-4H3;4*1-2H3/b;7-6-;;;; |
| InChIKey | KCLFXWRVVGEYAX-ACSSXNGNSA-N |
| XLogP | 11.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|