C34H60O7P2 — CID 88706439
2-tert-butyl-1-hexoxy-4-hexyl-3-methylbenzene;(2-tert-butyl-4-methylphenyl) dihydrogen phosphite;phosphorous acid (PubChem CID 88706439) has the molecular formula C34H60O7P2 and a molecular weight of 642.80 g/mol. Its IUPAC name is 2-tert-butyl-1-hexoxy-4-hexyl-3-methylbenzene;(2-tert-butyl-4-methylphenyl) dihydrogen phosphite;phosphorous acid.
| Compound Name | 2-tert-butyl-1-hexoxy-4-hexyl-3-methylbenzene;(2-tert-butyl-4-methylphenyl) dihydrogen phosphite;phosphorous acid |
|---|---|
| PubChem CID | 88706439 |
| Molecular Formula | C34H60O7P2 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.38 |
| IUPAC Name | 2-tert-butyl-1-hexoxy-4-hexyl-3-methylbenzene;(2-tert-butyl-4-methylphenyl) dihydrogen phosphite;phosphorous acid |
| SMILES | CCCCCCOc1ccc(CCCCCC)c(C)c1C(C)(C)C.Cc1ccc(OP(O)O)c(C(C)(C)C)c1.OP(O)O |
| InChI | InChI=1S/C23H40O.C11H17O3P.H3O3P/c1-7-9-11-13-15-20-16-17-21(24-18-14-12-10-8-2)22(19(20)3)23(4,5)6;1-8-5-6-10(14-15(12)13)9(7-8)11(2,3)4;1-4(2)3/h16-17H,7-15,18H2,1-6H3;5-7,12-13H,1-4H3;1-3H |
| InChIKey | WCAYNRMEIBIXCH-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|