C24H43O3PS — CID 23331135
dihydroxy-sulfanylidene-(2,3,4-trihexylphenoxy)-λ5-phosphane (PubChem CID 23331135) has the molecular formula C24H43O3PS and a molecular weight of 442.65 g/mol. Its IUPAC name is dihydroxy-sulfanylidene-(2,3,4-trihexylphenoxy)-λ5-phosphane.
| Compound Name | dihydroxy-sulfanylidene-(2,3,4-trihexylphenoxy)-λ5-phosphane |
|---|---|
| PubChem CID | 23331135 |
| Molecular Formula | C24H43O3PS |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | dihydroxy-sulfanylidene-(2,3,4-trihexylphenoxy)-λ5-phosphane |
| SMILES | CCCCCCc1ccc(OP(O)(O)=S)c(CCCCCC)c1CCCCCC |
| InChI | InChI=1S/C24H43O3PS/c1-4-7-10-13-16-21-19-20-24(27-28(25,26)29)23(18-15-12-9-6-3)22(21)17-14-11-8-5-2/h19-20H,4-18H2,1-3H3,(H2,25,26,29) |
| InChIKey | AJAJIMRWUJTHHP-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|