C20H35O3PS — CID 141318891
(2,3-diheptylphenoxy)-dihydroxy-sulfanylidene-λ5-phosphane (PubChem CID 141318891) has the molecular formula C20H35O3PS and a molecular weight of 386.54 g/mol. Its IUPAC name is (2,3-diheptylphenoxy)-dihydroxy-sulfanylidene-λ5-phosphane.
| Compound Name | (2,3-diheptylphenoxy)-dihydroxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 141318891 |
| Molecular Formula | C20H35O3PS |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | (2,3-diheptylphenoxy)-dihydroxy-sulfanylidene-λ5-phosphane |
| SMILES | CCCCCCCc1cccc(OP(O)(O)=S)c1CCCCCCC |
| InChI | InChI=1S/C20H35O3PS/c1-3-5-7-9-11-14-18-15-13-17-20(23-24(21,22)25)19(18)16-12-10-8-6-4-2/h13,15,17H,3-12,14,16H2,1-2H3,(H2,21,22,25) |
| InChIKey | AGDULHKYDZBZNE-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|