C24H42ClO3PS — CID 88766584
[[2,3-di(nonyl)phenoxy]-hydroxyphosphinothioyl] hypochlorite (PubChem CID 88766584) has the molecular formula C24H42ClO3PS and a molecular weight of 477.09 g/mol. Its IUPAC name is [[2,3-di(nonyl)phenoxy]-hydroxyphosphinothioyl] hypochlorite.
| Compound Name | [[2,3-di(nonyl)phenoxy]-hydroxyphosphinothioyl] hypochlorite |
|---|---|
| PubChem CID | 88766584 |
| Molecular Formula | C24H42ClO3PS |
| Molecular Weight | 477.09 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [[2,3-di(nonyl)phenoxy]-hydroxyphosphinothioyl] hypochlorite |
| SMILES | CCCCCCCCCc1cccc(OP(O)(=S)OCl)c1CCCCCCCCC |
| InChI | InChI=1S/C24H42ClO3PS/c1-3-5-7-9-11-13-15-18-22-19-17-21-24(27-29(26,30)28-25)23(22)20-16-14-12-10-8-6-4-2/h17,19,21H,3-16,18,20H2,1-2H3,(H,26,30) |
| InChIKey | JQCYBDPKOAXDEC-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.09 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|