C20H33O2PS2Zn — CID 68945518
zinc (2,3-diheptylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane (PubChem CID 68945518) has the molecular formula C20H33O2PS2Zn and a molecular weight of 465.98 g/mol. Its IUPAC name is zinc (2,3-diheptylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane.
| Compound Name | zinc (2,3-diheptylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane |
|---|---|
| PubChem CID | 68945518 |
| Molecular Formula | C20H33O2PS2Zn |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | zinc (2,3-diheptylphenoxy)-oxido-sulfanylidene-sulfido-λ5-phosphane |
| SMILES | CCCCCCCc1cccc(OP([O-])(=S)[S-])c1CCCCCCC.[Zn+2] |
| InChI | InChI=1S/C20H35O2PS2.Zn/c1-3-5-7-9-11-14-18-15-13-17-20(22-23(21,24)25)19(18)16-12-10-8-6-4-2;/h13,15,17H,3-12,14,16H2,1-2H3,(H2,21,24,25);/q;+2/p-2 |
| InChIKey | RXVGSLUYLVJRTA-UHFFFAOYSA-L |
| XLogP | 6.22 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|